C18H10N2O4S — CID 86233834
5-(3,4-dicyanophenoxy)naphthalene-1-sulfonic acid (PubChem CID 86233834) has the molecular formula C18H10N2O4S and a molecular weight of 350.36 g/mol. Its IUPAC name is 5-(3,4-dicyanophenoxy)naphthalene-1-sulfonic acid.
| Compound Name | 5-(3,4-dicyanophenoxy)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 86233834 |
| Molecular Formula | C18H10N2O4S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 5-(3,4-dicyanophenoxy)naphthalene-1-sulfonic acid |
| SMILES | N#Cc1ccc(Oc2cccc3c(S(=O)(=O)O)cccc23)cc1C#N |
| InChI | InChI=1S/C18H10N2O4S/c19-10-12-7-8-14(9-13(12)11-20)24-17-5-1-4-16-15(17)3-2-6-18(16)25(21,22)23/h1-9H,(H,21,22,23) |
| InChIKey | BESXFRLLOAVCPS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|