C24H30ClN2O2+ — CID 69312244
[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-1-yl]methyl N-[2-(3-chlorophenyl)-6-methylphenyl]carbamate (PubChem CID 69312244) has the molecular formula C24H30ClN2O2+ and a molecular weight of 413.97 g/mol. Its IUPAC name is [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-1-yl]methyl N-[2-(3-chlorophenyl)-6-methylphenyl]carbamate.
| Compound Name | [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-1-yl]methyl N-[2-(3-chlorophenyl)-6-methylphenyl]carbamate |
|---|---|
| PubChem CID | 69312244 |
| Molecular Formula | C24H30ClN2O2+ |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-1-yl]methyl N-[2-(3-chlorophenyl)-6-methylphenyl]carbamate |
| SMILES | Cc1cccc(-c2cccc(Cl)c2)c1NC(=O)OC[C@]12CCC[C@H](CC1)[N+]2(C)C |
| InChI | InChI=1S/C24H29ClN2O2/c1-17-7-4-11-21(18-8-5-9-19(25)15-18)22(17)26-23(28)29-16-24-13-6-10-20(12-14-24)27(24,2)3/h4-5,7-9,11,15,20H,6,10,12-14,16H2,1-3H3/p+1/t20-,24+/m1/s1 |
| InChIKey | XEKQKXFWGCTYSH-YKSBVNFPSA-O |
| XLogP | 6.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|