C20H24N2O2S — CID 11573985
8-azabicyclo[3.2.1]octan-3-ylmethyl N-(2-methyl-6-thiophen-3-ylphenyl)carbamate (PubChem CID 11573985) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is 8-azabicyclo[3.2.1]octan-3-ylmethyl N-(2-methyl-6-thiophen-3-ylphenyl)carbamate.
| Compound Name | 8-azabicyclo[3.2.1]octan-3-ylmethyl N-(2-methyl-6-thiophen-3-ylphenyl)carbamate |
|---|---|
| PubChem CID | 11573985 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 8-azabicyclo[3.2.1]octan-3-ylmethyl N-(2-methyl-6-thiophen-3-ylphenyl)carbamate |
| SMILES | Cc1cccc(-c2ccsc2)c1NC(=O)OCC1CC2CCC(C1)N2 |
| InChI | InChI=1S/C20H24N2O2S/c1-13-3-2-4-18(15-7-8-25-12-15)19(13)22-20(23)24-11-14-9-16-5-6-17(10-14)21-16/h2-4,7-8,12,14,16-17,21H,5-6,9-11H2,1H3,(H,22,23) |
| InChIKey | USKFGDIMMVJRGB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |