C22H25FN2O2 — CID 11260212
8-azabicyclo[3.2.1]octan-3-ylmethyl N-[2-(2-fluorophenyl)-5-methylphenyl]carbamate (PubChem CID 11260212) has the molecular formula C22H25FN2O2 and a molecular weight of 368.45 g/mol. Its IUPAC name is 8-azabicyclo[3.2.1]octan-3-ylmethyl N-[2-(2-fluorophenyl)-5-methylphenyl]carbamate.
| Compound Name | 8-azabicyclo[3.2.1]octan-3-ylmethyl N-[2-(2-fluorophenyl)-5-methylphenyl]carbamate |
|---|---|
| PubChem CID | 11260212 |
| Molecular Formula | C22H25FN2O2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 8-azabicyclo[3.2.1]octan-3-ylmethyl N-[2-(2-fluorophenyl)-5-methylphenyl]carbamate |
| SMILES | Cc1ccc(-c2ccccc2F)c(NC(=O)OCC2CC3CCC(C2)N3)c1 |
| InChI | InChI=1S/C22H25FN2O2/c1-14-6-9-19(18-4-2-3-5-20(18)23)21(10-14)25-22(26)27-13-15-11-16-7-8-17(12-15)24-16/h2-6,9-10,15-17,24H,7-8,11-13H2,1H3,(H,25,26) |
| InChIKey | VIEJSQCSCZHUKL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |