C22H23F3N2O3 — CID 90851842
8-azabicyclo[3.2.1]octan-3-ylmethyl N-[2-[3-(trifluoromethoxy)phenyl]phenyl]carbamate (PubChem CID 90851842) has the molecular formula C22H23F3N2O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is 8-azabicyclo[3.2.1]octan-3-ylmethyl N-[2-[3-(trifluoromethoxy)phenyl]phenyl]carbamate.
| Compound Name | 8-azabicyclo[3.2.1]octan-3-ylmethyl N-[2-[3-(trifluoromethoxy)phenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 90851842 |
| Molecular Formula | C22H23F3N2O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 8-azabicyclo[3.2.1]octan-3-ylmethyl N-[2-[3-(trifluoromethoxy)phenyl]phenyl]carbamate |
| SMILES | O=C(Nc1ccccc1-c1cccc(OC(F)(F)F)c1)OCC1CC2CCC(C1)N2 |
| InChI | InChI=1S/C22H23F3N2O3/c23-22(24,25)30-18-5-3-4-15(12-18)19-6-1-2-7-20(19)27-21(28)29-13-14-10-16-8-9-17(11-14)26-16/h1-7,12,14,16-17,26H,8-11,13H2,(H,27,28) |
| InChIKey | RLLKGFZUWVVCII-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |