C20H20F3NO2 — CID 66882043
3-[3-[3-(trifluoromethoxy)phenyl]phenoxy]-8-azabicyclo[3.2.1]octane (PubChem CID 66882043) has the molecular formula C20H20F3NO2 and a molecular weight of 363.38 g/mol. Its IUPAC name is 3-[3-[3-(trifluoromethoxy)phenyl]phenoxy]-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-[3-[3-(trifluoromethoxy)phenyl]phenoxy]-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 66882043 |
| Molecular Formula | C20H20F3NO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 3-[3-[3-(trifluoromethoxy)phenyl]phenoxy]-8-azabicyclo[3.2.1]octane |
| SMILES | FC(F)(F)Oc1cccc(-c2cccc(OC3CC4CCC(C3)N4)c2)c1 |
| InChI | InChI=1S/C20H20F3NO2/c21-20(22,23)26-18-6-2-4-14(10-18)13-3-1-5-17(9-13)25-19-11-15-7-8-16(12-19)24-15/h1-6,9-10,15-16,19,24H,7-8,11-12H2 |
| InChIKey | SCEKJCVZDOVFMQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |