C21H23FN2O2 — CID 11394093
8-azabicyclo[3.2.1]octan-3-ylmethyl N-(3-fluoro-2-phenylphenyl)carbamate (PubChem CID 11394093) has the molecular formula C21H23FN2O2 and a molecular weight of 354.42 g/mol. Its IUPAC name is 8-azabicyclo[3.2.1]octan-3-ylmethyl N-(3-fluoro-2-phenylphenyl)carbamate.
| Compound Name | 8-azabicyclo[3.2.1]octan-3-ylmethyl N-(3-fluoro-2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 11394093 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 8-azabicyclo[3.2.1]octan-3-ylmethyl N-(3-fluoro-2-phenylphenyl)carbamate |
| SMILES | O=C(Nc1cccc(F)c1-c1ccccc1)OCC1CC2CCC(C1)N2 |
| InChI | InChI=1S/C21H23FN2O2/c22-18-7-4-8-19(20(18)15-5-2-1-3-6-15)24-21(25)26-13-14-11-16-9-10-17(12-14)23-16/h1-8,14,16-17,23H,9-13H2,(H,24,25) |
| InChIKey | DMJKUCQTFUCACH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |