C12H15FN2O2 — CID 79337811
pyrrolidin-2-ylmethyl N-(2-fluorophenyl)carbamate (PubChem CID 79337811) has the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. Its IUPAC name is pyrrolidin-2-ylmethyl N-(2-fluorophenyl)carbamate.
| Compound Name | pyrrolidin-2-ylmethyl N-(2-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 79337811 |
| Molecular Formula | C12H15FN2O2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | pyrrolidin-2-ylmethyl N-(2-fluorophenyl)carbamate |
| SMILES | O=C(Nc1ccccc1F)OCC1CCCN1 |
| InChI | InChI=1S/C12H15FN2O2/c13-10-5-1-2-6-11(10)15-12(16)17-8-9-4-3-7-14-9/h1-2,5-6,9,14H,3-4,7-8H2,(H,15,16) |
| InChIKey | WWHXVSISFBWRAY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |