C14H20FN3O — CID 63304885
1-(2-fluorophenyl)-3-[(3-methylpiperidin-2-yl)methyl]urea (PubChem CID 63304885) has the molecular formula C14H20FN3O and a molecular weight of 265.33 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[(3-methylpiperidin-2-yl)methyl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[(3-methylpiperidin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 63304885 |
| Molecular Formula | C14H20FN3O |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[(3-methylpiperidin-2-yl)methyl]urea |
| SMILES | CC1CCCNC1CNC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C14H20FN3O/c1-10-5-4-8-16-13(10)9-17-14(19)18-12-7-3-2-6-11(12)15/h2-3,6-7,10,13,16H,4-5,8-9H2,1H3,(H2,17,18,19) |
| InChIKey | NOPPNOPYOHBBIQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |