C31H30N2O4 — CID 121411230
2-phenylbenzoic acid;[(2S)-pyrrolidin-2-yl]methyl N-(2-phenylphenyl)carbamate (PubChem CID 121411230) has the molecular formula C31H30N2O4 and a molecular weight of 494.59 g/mol. Its IUPAC name is 2-phenylbenzoic acid;[(2S)-pyrrolidin-2-yl]methyl N-(2-phenylphenyl)carbamate.
| Compound Name | 2-phenylbenzoic acid;[(2S)-pyrrolidin-2-yl]methyl N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 121411230 |
| Molecular Formula | C31H30N2O4 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 2-phenylbenzoic acid;[(2S)-pyrrolidin-2-yl]methyl N-(2-phenylphenyl)carbamate |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)OC[C@@H]1CCCN1.O=C(O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C18H20N2O2.C13H10O2/c21-18(22-13-15-9-6-12-19-15)20-17-11-5-4-10-16(17)14-7-2-1-3-8-14;14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-5,7-8,10-11,15,19H,6,9,12-13H2,(H,20,21);1-9H,(H,14,15)/t15-;/m0./s1 |
| InChIKey | SVBUKIODKAWVFM-RSAXXLAASA-N |
| XLogP | 6.71 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |