C16H22FN3O — CID 106629687
1-cyclopropyl-3-(2-fluorophenyl)-1-(piperidin-2-ylmethyl)urea (PubChem CID 106629687) has the molecular formula C16H22FN3O and a molecular weight of 291.37 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2-fluorophenyl)-1-(piperidin-2-ylmethyl)urea.
| Compound Name | 1-cyclopropyl-3-(2-fluorophenyl)-1-(piperidin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 106629687 |
| Molecular Formula | C16H22FN3O |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1-cyclopropyl-3-(2-fluorophenyl)-1-(piperidin-2-ylmethyl)urea |
| SMILES | O=C(Nc1ccccc1F)N(CC1CCCCN1)C1CC1 |
| InChI | InChI=1S/C16H22FN3O/c17-14-6-1-2-7-15(14)19-16(21)20(13-8-9-13)11-12-5-3-4-10-18-12/h1-2,6-7,12-13,18H,3-5,8-11H2,(H,19,21) |
| InChIKey | MDUQDGKJQNEVRM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |