C18H24N2O — CID 106626913
(E)-N-cyclopropyl-3-phenyl-N-(piperidin-2-ylmethyl)prop-2-enamide (PubChem CID 106626913) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is (E)-N-cyclopropyl-3-phenyl-N-(piperidin-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-N-cyclopropyl-3-phenyl-N-(piperidin-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 106626913 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | (E)-N-cyclopropyl-3-phenyl-N-(piperidin-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N(CC1CCCCN1)C1CC1 |
| InChI | InChI=1S/C18H24N2O/c21-18(12-9-15-6-2-1-3-7-15)20(17-10-11-17)14-16-8-4-5-13-19-16/h1-3,6-7,9,12,16-17,19H,4-5,8,10-11,13-14H2/b12-9+ |
| InChIKey | DQGQJBHONJBVCJ-FMIVXFBMSA-N |
| XLogP | 2.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|