C16H24N2 — CID 106635606
(E)-N-methyl-3-phenyl-N-(piperidin-2-ylmethyl)prop-2-en-1-amine (PubChem CID 106635606) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (E)-N-methyl-3-phenyl-N-(piperidin-2-ylmethyl)prop-2-en-1-amine.
| Compound Name | (E)-N-methyl-3-phenyl-N-(piperidin-2-ylmethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 106635606 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (E)-N-methyl-3-phenyl-N-(piperidin-2-ylmethyl)prop-2-en-1-amine |
| SMILES | CN(C/C=C/c1ccccc1)CC1CCCCN1 |
| InChI | InChI=1S/C16H24N2/c1-18(14-16-11-5-6-12-17-16)13-7-10-15-8-3-2-4-9-15/h2-4,7-10,16-17H,5-6,11-14H2,1H3/b10-7+ |
| InChIKey | DXNHTWJWVWTFQP-JXMROGBWSA-N |
| XLogP | 2.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |