C21H26BrFN2O2S — CID 69439315
(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-[(2-fluorophenyl)methyl]-N-thiophen-2-ylcarbamate bromide (PubChem CID 69439315) has the molecular formula C21H26BrFN2O2S and a molecular weight of 469.42 g/mol. Its IUPAC name is (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-[(2-fluorophenyl)methyl]-N-thiophen-2-ylcarbamate bromide.
| Compound Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-[(2-fluorophenyl)methyl]-N-thiophen-2-ylcarbamate bromide |
|---|---|
| PubChem CID | 69439315 |
| Molecular Formula | C21H26BrFN2O2S |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-[(2-fluorophenyl)methyl]-N-thiophen-2-ylcarbamate bromide |
| SMILES | C[N+]1(C)C2CCC1CC(OC(=O)N(Cc1ccccc1F)c1cccs1)C2.[Br-] |
| InChI | InChI=1S/C21H26FN2O2S.BrH/c1-24(2)16-9-10-17(24)13-18(12-16)26-21(25)23(20-8-5-11-27-20)14-15-6-3-4-7-19(15)22;/h3-8,11,16-18H,9-10,12-14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | WLBBZBSUFZKPGA-UHFFFAOYSA-M |
| XLogP | 1.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|