C21H25BrF2N2O2S — CID 11720075
[(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-[(2,4-difluorophenyl)methyl]-N-thiophen-2-ylcarbamate bromide (PubChem CID 11720075) has the molecular formula C21H25BrF2N2O2S and a molecular weight of 487.41 g/mol. Its IUPAC name is [(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-[(2,4-difluorophenyl)methyl]-N-thiophen-2-ylcarbamate bromide.
| Compound Name | [(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-[(2,4-difluorophenyl)methyl]-N-thiophen-2-ylcarbamate bromide |
|---|---|
| PubChem CID | 11720075 |
| Molecular Formula | C21H25BrF2N2O2S |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | [(1R,5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] N-[(2,4-difluorophenyl)methyl]-N-thiophen-2-ylcarbamate bromide |
| SMILES | C[N+]1(C)[C@@H]2CC[C@H]1CC(OC(=O)N(Cc1ccc(F)cc1F)c1cccs1)C2.[Br-] |
| InChI | InChI=1S/C21H25F2N2O2S.BrH/c1-25(2)16-7-8-17(25)12-18(11-16)27-21(26)24(20-4-3-9-28-20)13-14-5-6-15(22)10-19(14)23;/h3-6,9-10,16-18H,7-8,11-13H2,1-2H3;1H/q+1;/p-1/t16-,17+,18?; |
| InChIKey | ZNJZCKBOWWOMQL-IESHXZMMSA-M |
| XLogP | 1.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|