C21H35FN4O2 — CID 153394509
ethane;ethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate (PubChem CID 153394509) has the molecular formula C21H35FN4O2 and a molecular weight of 394.54 g/mol. Its IUPAC name is ethane;ethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate.
| Compound Name | ethane;ethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 153394509 |
| Molecular Formula | C21H35FN4O2 |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | ethane;ethyl N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]carbamate |
| SMILES | CC.CC.CC.CCOC(=O)Nc1ccc(NCc2ccc(F)cc2)nc1N |
| InChI | InChI=1S/C15H17FN4O2.3C2H6/c1-2-22-15(21)19-12-7-8-13(20-14(12)17)18-9-10-3-5-11(16)6-4-10;3*1-2/h3-8H,2,9H2,1H3,(H,19,21)(H3,17,18,20);3*1-2H3 |
| InChIKey | ICQOFAGJTRBCBD-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |