C16H18BrFN4O — CID 110187575
N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]-4-bromobutanamide (PubChem CID 110187575) has the molecular formula C16H18BrFN4O and a molecular weight of 381.25 g/mol. Its IUPAC name is N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]-4-bromobutanamide.
| Compound Name | N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]-4-bromobutanamide |
|---|---|
| PubChem CID | 110187575 |
| Molecular Formula | C16H18BrFN4O |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]-4-bromobutanamide |
| SMILES | Nc1nc(NCc2ccc(F)cc2)ccc1NC(=O)CCCBr |
| InChI | InChI=1S/C16H18BrFN4O/c17-9-1-2-15(23)21-13-7-8-14(22-16(13)19)20-10-11-3-5-12(18)6-4-11/h3-8H,1-2,9-10H2,(H,21,23)(H3,19,20,22) |
| InChIKey | CBRNVDUBCPHACY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|