C20H17F3N4O2 — CID 110186262
phenyl N-[2-amino-6-[[4-(trifluoromethyl)phenyl]methylamino]-3-pyridinyl]carbamate (PubChem CID 110186262) has the molecular formula C20H17F3N4O2 and a molecular weight of 402.38 g/mol. Its IUPAC name is phenyl N-[2-amino-6-[[4-(trifluoromethyl)phenyl]methylamino]-3-pyridinyl]carbamate.
| Compound Name | phenyl N-[2-amino-6-[[4-(trifluoromethyl)phenyl]methylamino]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 110186262 |
| Molecular Formula | C20H17F3N4O2 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | phenyl N-[2-amino-6-[[4-(trifluoromethyl)phenyl]methylamino]-3-pyridinyl]carbamate |
| SMILES | Nc1nc(NCc2ccc(C(F)(F)F)cc2)ccc1NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C20H17F3N4O2/c21-20(22,23)14-8-6-13(7-9-14)12-25-17-11-10-16(18(24)27-17)26-19(28)29-15-4-2-1-3-5-15/h1-11H,12H2,(H,26,28)(H3,24,25,27) |
| InChIKey | PCBLXIUFECEBEY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |