C19H19N5O4S — CID 110187356
phenyl N-[2-amino-6-[(4-sulfamoylphenyl)methylamino]-3-pyridinyl]carbamate (PubChem CID 110187356) has the molecular formula C19H19N5O4S and a molecular weight of 413.46 g/mol. Its IUPAC name is phenyl N-[2-amino-6-[(4-sulfamoylphenyl)methylamino]-3-pyridinyl]carbamate.
| Compound Name | phenyl N-[2-amino-6-[(4-sulfamoylphenyl)methylamino]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 110187356 |
| Molecular Formula | C19H19N5O4S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | phenyl N-[2-amino-6-[(4-sulfamoylphenyl)methylamino]-3-pyridinyl]carbamate |
| SMILES | Nc1nc(NCc2ccc(S(N)(=O)=O)cc2)ccc1NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C19H19N5O4S/c20-18-16(23-19(25)28-14-4-2-1-3-5-14)10-11-17(24-18)22-12-13-6-8-15(9-7-13)29(21,26)27/h1-11H,12H2,(H,23,25)(H3,20,22,24)(H2,21,26,27) |
| InChIKey | CGVCEKFYJJRUHA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 149.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |