C17H18F3N3O2 — CID 10269475
ethyl N-[2-amino-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]carbamate (PubChem CID 10269475) has the molecular formula C17H18F3N3O2 and a molecular weight of 353.34 g/mol. Its IUPAC name is ethyl N-[2-amino-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]carbamate.
| Compound Name | ethyl N-[2-amino-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 10269475 |
| Molecular Formula | C17H18F3N3O2 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | ethyl N-[2-amino-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccc(C(F)(F)F)cc2)cc1N |
| InChI | InChI=1S/C17H18F3N3O2/c1-2-25-16(24)23-15-8-7-13(9-14(15)21)22-10-11-3-5-12(6-4-11)17(18,19)20/h3-9,22H,2,10,21H2,1H3,(H,23,24) |
| InChIKey | DXXOREOJVZZYGH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|