C24H30F5N3O — CID 154663635
N-[2-amino-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-9,10-difluorodecanamide (PubChem CID 154663635) has the molecular formula C24H30F5N3O and a molecular weight of 471.51 g/mol. Its IUPAC name is N-[2-amino-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-9,10-difluorodecanamide.
| Compound Name | N-[2-amino-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-9,10-difluorodecanamide |
|---|---|
| PubChem CID | 154663635 |
| Molecular Formula | C24H30F5N3O |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | N-[2-amino-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-9,10-difluorodecanamide |
| SMILES | Nc1cc(NCc2ccc(C(F)(F)F)cc2)ccc1NC(=O)CCCCCCCC(F)CF |
| InChI | InChI=1S/C24H30F5N3O/c25-15-19(26)6-4-2-1-3-5-7-23(33)32-22-13-12-20(14-21(22)30)31-16-17-8-10-18(11-9-17)24(27,28)29/h8-14,19,31H,1-7,15-16,30H2,(H,32,33) |
| InChIKey | HJCUTAPALRTANI-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|