C27H36F3N3O — CID 154663601
N-[2-piperidin-1-yl-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]octanamide (PubChem CID 154663601) has the molecular formula C27H36F3N3O and a molecular weight of 475.60 g/mol. Its IUPAC name is N-[2-piperidin-1-yl-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]octanamide.
| Compound Name | N-[2-piperidin-1-yl-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]octanamide |
|---|---|
| PubChem CID | 154663601 |
| Molecular Formula | C27H36F3N3O |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | N-[2-piperidin-1-yl-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1ccc(NCc2ccc(C(F)(F)F)cc2)cc1N1CCCCC1 |
| InChI | InChI=1S/C27H36F3N3O/c1-2-3-4-5-7-10-26(34)32-24-16-15-23(19-25(24)33-17-8-6-9-18-33)31-20-21-11-13-22(14-12-21)27(28,29)30/h11-16,19,31H,2-10,17-18,20H2,1H3,(H,32,34) |
| InChIKey | BYOLSMVMXCTOBX-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|