C27H29F4N3O — CID 154663608
N-[2-amino-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-7-(4-fluorophenyl)heptanamide (PubChem CID 154663608) has the molecular formula C27H29F4N3O and a molecular weight of 487.54 g/mol. Its IUPAC name is N-[2-amino-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-7-(4-fluorophenyl)heptanamide.
| Compound Name | N-[2-amino-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-7-(4-fluorophenyl)heptanamide |
|---|---|
| PubChem CID | 154663608 |
| Molecular Formula | C27H29F4N3O |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | N-[2-amino-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-7-(4-fluorophenyl)heptanamide |
| SMILES | Nc1cc(NCc2ccc(C(F)(F)F)cc2)ccc1NC(=O)CCCCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C27H29F4N3O/c28-22-13-9-19(10-14-22)5-3-1-2-4-6-26(35)34-25-16-15-23(17-24(25)32)33-18-20-7-11-21(12-8-20)27(29,30)31/h7-17,33H,1-6,18,32H2,(H,34,35) |
| InChIKey | LECBVEQUPJEQIO-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|