C24H23F4N3O — CID 166970035
N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-4-phenylbutanamide (PubChem CID 166970035) has the molecular formula C24H23F4N3O and a molecular weight of 445.46 g/mol. Its IUPAC name is N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-4-phenylbutanamide.
| Compound Name | N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 166970035 |
| Molecular Formula | C24H23F4N3O |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-4-phenylbutanamide |
| SMILES | Nc1c(NC(=O)CCCc2ccccc2)ccc(NCc2ccc(C(F)(F)F)cc2)c1F |
| InChI | InChI=1S/C24H23F4N3O/c25-22-19(30-15-17-9-11-18(12-10-17)24(26,27)28)13-14-20(23(22)29)31-21(32)8-4-7-16-5-2-1-3-6-16/h1-3,5-6,9-14,30H,4,7-8,15,29H2,(H,31,32) |
| InChIKey | GWYIKMFSNHOCGY-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|