C22H25F6N3O — CID 154663641
N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-7,8-difluorooctanamide (PubChem CID 154663641) has the molecular formula C22H25F6N3O and a molecular weight of 461.45 g/mol. Its IUPAC name is N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-7,8-difluorooctanamide.
| Compound Name | N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-7,8-difluorooctanamide |
|---|---|
| PubChem CID | 154663641 |
| Molecular Formula | C22H25F6N3O |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-7,8-difluorooctanamide |
| SMILES | Nc1c(NC(=O)CCCCCC(F)CF)ccc(NCc2ccc(C(F)(F)F)cc2)c1F |
| InChI | InChI=1S/C22H25F6N3O/c23-12-16(24)4-2-1-3-5-19(32)31-18-11-10-17(20(25)21(18)29)30-13-14-6-8-15(9-7-14)22(26,27)28/h6-11,16,30H,1-5,12-13,29H2,(H,31,32) |
| InChIKey | QLSKQJKVKGWCAN-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|