C24H29F6N3O — CID 154663732
N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-9,10-difluorodecanamide (PubChem CID 154663732) has the molecular formula C24H29F6N3O and a molecular weight of 489.50 g/mol. Its IUPAC name is N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-9,10-difluorodecanamide.
| Compound Name | N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-9,10-difluorodecanamide |
|---|---|
| PubChem CID | 154663732 |
| Molecular Formula | C24H29F6N3O |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-9,10-difluorodecanamide |
| SMILES | Nc1c(NC(=O)CCCCCCCC(F)CF)ccc(NCc2ccc(C(F)(F)F)cc2)c1F |
| InChI | InChI=1S/C24H29F6N3O/c25-14-18(26)6-4-2-1-3-5-7-21(34)33-20-13-12-19(22(27)23(20)31)32-15-16-8-10-17(11-9-16)24(28,29)30/h8-13,18,32H,1-7,14-15,31H2,(H,33,34) |
| InChIKey | BLPHNOWQPZHVTB-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|