C9H11F2N3O — CID 110479002
3-amino-N-(2-amino-3,4-difluorophenyl)propanamide (PubChem CID 110479002) has the molecular formula C9H11F2N3O and a molecular weight of 215.20 g/mol. Its IUPAC name is 3-amino-N-(2-amino-3,4-difluorophenyl)propanamide.
| Compound Name | 3-amino-N-(2-amino-3,4-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 110479002 |
| Molecular Formula | C9H11F2N3O |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 3-amino-N-(2-amino-3,4-difluorophenyl)propanamide |
| SMILES | NCCC(=O)Nc1ccc(F)c(F)c1N |
| InChI | InChI=1S/C9H11F2N3O/c10-5-1-2-6(9(13)8(5)11)14-7(15)3-4-12/h1-2H,3-4,12-13H2,(H,14,15) |
| InChIKey | VAVLLVXUGUTQGZ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|