C15H13F3N2O — CID 109033887
N-phenyl-3-(2,3,4-trifluoroanilino)propanamide (PubChem CID 109033887) has the molecular formula C15H13F3N2O and a molecular weight of 294.28 g/mol. Its IUPAC name is N-phenyl-3-(2,3,4-trifluoroanilino)propanamide.
| Compound Name | N-phenyl-3-(2,3,4-trifluoroanilino)propanamide |
|---|---|
| PubChem CID | 109033887 |
| Molecular Formula | C15H13F3N2O |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-phenyl-3-(2,3,4-trifluoroanilino)propanamide |
| SMILES | O=C(CCNc1ccc(F)c(F)c1F)Nc1ccccc1 |
| InChI | InChI=1S/C15H13F3N2O/c16-11-6-7-12(15(18)14(11)17)19-9-8-13(21)20-10-4-2-1-3-5-10/h1-7,19H,8-9H2,(H,20,21) |
| InChIKey | FFQFYWLQHAAIIJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|