C16H15F3N2O — CID 109034329
3-(3-methylanilino)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 109034329) has the molecular formula C16H15F3N2O and a molecular weight of 308.30 g/mol. Its IUPAC name is 3-(3-methylanilino)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 3-(3-methylanilino)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 109034329 |
| Molecular Formula | C16H15F3N2O |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 3-(3-methylanilino)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | Cc1cccc(NCCC(=O)Nc2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C16H15F3N2O/c1-10-3-2-4-11(9-10)20-8-7-14(22)21-13-6-5-12(17)15(18)16(13)19/h2-6,9,20H,7-8H2,1H3,(H,21,22) |
| InChIKey | SAYJLCWIRFAFCO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|