C14H17F3N2O2 — CID 18155036
2,2-dimethyl-N-[3-oxo-3-(2,3,4-trifluoroanilino)propyl]propanamide (PubChem CID 18155036) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is 2,2-dimethyl-N-[3-oxo-3-(2,3,4-trifluoroanilino)propyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[3-oxo-3-(2,3,4-trifluoroanilino)propyl]propanamide |
|---|---|
| PubChem CID | 18155036 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2,2-dimethyl-N-[3-oxo-3-(2,3,4-trifluoroanilino)propyl]propanamide |
| SMILES | CC(C)(C)C(=O)NCCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H17F3N2O2/c1-14(2,3)13(21)18-7-6-10(20)19-9-5-4-8(15)11(16)12(9)17/h4-5H,6-7H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | OSSRFSKTGDQKKE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|