C13H17F3N2O — CID 109012916
3-(2-methylpropylamino)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 109012916) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is 3-(2-methylpropylamino)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 3-(2-methylpropylamino)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 109012916 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 3-(2-methylpropylamino)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | CC(C)CNCCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H17F3N2O/c1-8(2)7-17-6-5-11(19)18-10-4-3-9(14)12(15)13(10)16/h3-4,8,17H,5-7H2,1-2H3,(H,18,19) |
| InChIKey | HKQZRSZGXMJHNF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|