C20H22F3N3O — CID 109041851
3-(4-piperidin-1-ylanilino)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 109041851) has the molecular formula C20H22F3N3O and a molecular weight of 377.41 g/mol. Its IUPAC name is 3-(4-piperidin-1-ylanilino)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 3-(4-piperidin-1-ylanilino)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 109041851 |
| Molecular Formula | C20H22F3N3O |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 3-(4-piperidin-1-ylanilino)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | O=C(CCNc1ccc(N2CCCCC2)cc1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H22F3N3O/c21-16-8-9-17(20(23)19(16)22)25-18(27)10-11-24-14-4-6-15(7-5-14)26-12-2-1-3-13-26/h4-9,24H,1-3,10-13H2,(H,25,27) |
| InChIKey | PASGBAJTMCIYEP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|