C20H23F2N3O — CID 109041838
N-(2,4-difluorophenyl)-3-(4-piperidin-1-ylanilino)propanamide (PubChem CID 109041838) has the molecular formula C20H23F2N3O and a molecular weight of 359.42 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-3-(4-piperidin-1-ylanilino)propanamide.
| Compound Name | N-(2,4-difluorophenyl)-3-(4-piperidin-1-ylanilino)propanamide |
|---|---|
| PubChem CID | 109041838 |
| Molecular Formula | C20H23F2N3O |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-(2,4-difluorophenyl)-3-(4-piperidin-1-ylanilino)propanamide |
| SMILES | O=C(CCNc1ccc(N2CCCCC2)cc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C20H23F2N3O/c21-15-4-9-19(18(22)14-15)24-20(26)10-11-23-16-5-7-17(8-6-16)25-12-2-1-3-13-25/h4-9,14,23H,1-3,10-13H2,(H,24,26) |
| InChIKey | JEBCIZLHWMIYOL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|