C18H18F4N2O — CID 10066693
N-[2-fluoro-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]butanamide (PubChem CID 10066693) has the molecular formula C18H18F4N2O and a molecular weight of 354.35 g/mol. Its IUPAC name is N-[2-fluoro-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]butanamide.
| Compound Name | N-[2-fluoro-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 10066693 |
| Molecular Formula | C18H18F4N2O |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-[2-fluoro-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(CNc2ccc(C(F)(F)F)cc2)cc1F |
| InChI | InChI=1S/C18H18F4N2O/c1-2-3-17(25)24-16-9-4-12(10-15(16)19)11-23-14-7-5-13(6-8-14)18(20,21)22/h4-10,23H,2-3,11H2,1H3,(H,24,25) |
| InChIKey | YIJKAGUJZZPFTO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |