C24H29F3N2O — CID 154663741
4-cyclohexyl-N-[4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]butanamide (PubChem CID 154663741) has the molecular formula C24H29F3N2O and a molecular weight of 418.50 g/mol. Its IUPAC name is 4-cyclohexyl-N-[4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]butanamide.
| Compound Name | 4-cyclohexyl-N-[4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]butanamide |
|---|---|
| PubChem CID | 154663741 |
| Molecular Formula | C24H29F3N2O |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 4-cyclohexyl-N-[4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]butanamide |
| SMILES | O=C(CCCC1CCCCC1)Nc1ccc(NCc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H29F3N2O/c25-24(26,27)20-11-9-19(10-12-20)17-28-21-13-15-22(16-14-21)29-23(30)8-4-7-18-5-2-1-3-6-18/h9-16,18,28H,1-8,17H2,(H,29,30) |
| InChIKey | PHUJZLUCFOSGGG-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |