C21H23F6N3O — CID 154663757
N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-6,7-difluoroheptanamide (PubChem CID 154663757) has the molecular formula C21H23F6N3O and a molecular weight of 447.42 g/mol. Its IUPAC name is N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-6,7-difluoroheptanamide.
| Compound Name | N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-6,7-difluoroheptanamide |
|---|---|
| PubChem CID | 154663757 |
| Molecular Formula | C21H23F6N3O |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | N-[2-amino-3-fluoro-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]-6,7-difluoroheptanamide |
| SMILES | Nc1c(NC(=O)CCCCC(F)CF)ccc(NCc2ccc(C(F)(F)F)cc2)c1F |
| InChI | InChI=1S/C21H23F6N3O/c22-11-15(23)3-1-2-4-18(31)30-17-10-9-16(19(24)20(17)28)29-12-13-5-7-14(8-6-13)21(25,26)27/h5-10,15,29H,1-4,11-12,28H2,(H,30,31) |
| InChIKey | BFEAKSCJIYYIII-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|