C23H30FN3O2 — CID 45255100
N'-(2-amino-4-tert-butylphenyl)-N-(4-fluorophenyl)heptanediamide (PubChem CID 45255100) has the molecular formula C23H30FN3O2 and a molecular weight of 399.51 g/mol. Its IUPAC name is N'-(2-amino-4-tert-butylphenyl)-N-(4-fluorophenyl)heptanediamide.
| Compound Name | N'-(2-amino-4-tert-butylphenyl)-N-(4-fluorophenyl)heptanediamide |
|---|---|
| PubChem CID | 45255100 |
| Molecular Formula | C23H30FN3O2 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | N'-(2-amino-4-tert-butylphenyl)-N-(4-fluorophenyl)heptanediamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)CCCCCC(=O)Nc2ccc(F)cc2)c(N)c1 |
| InChI | InChI=1S/C23H30FN3O2/c1-23(2,3)16-9-14-20(19(25)15-16)27-22(29)8-6-4-5-7-21(28)26-18-12-10-17(24)11-13-18/h9-15H,4-8,25H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | OHSMNGIUDTYJSN-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|