C21H24FN3O4 — CID 45255098
methyl 4-amino-3-[[7-(4-fluoroanilino)-7-oxoheptanoyl]amino]benzoate (PubChem CID 45255098) has the molecular formula C21H24FN3O4 and a molecular weight of 401.44 g/mol. Its IUPAC name is methyl 4-amino-3-[[7-(4-fluoroanilino)-7-oxoheptanoyl]amino]benzoate.
| Compound Name | methyl 4-amino-3-[[7-(4-fluoroanilino)-7-oxoheptanoyl]amino]benzoate |
|---|---|
| PubChem CID | 45255098 |
| Molecular Formula | C21H24FN3O4 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | methyl 4-amino-3-[[7-(4-fluoroanilino)-7-oxoheptanoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(N)c(NC(=O)CCCCCC(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H24FN3O4/c1-29-21(28)14-7-12-17(23)18(13-14)25-20(27)6-4-2-3-5-19(26)24-16-10-8-15(22)9-11-16/h7-13H,2-6,23H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | OLKMKRNSHOBTTP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|