C16H19FN4O3 — CID 45255722
N-(2-amino-4-fluorophenyl)-N'-(1,2-oxazol-3-yl)heptanediamide (PubChem CID 45255722) has the molecular formula C16H19FN4O3 and a molecular weight of 334.35 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-N'-(1,2-oxazol-3-yl)heptanediamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-N'-(1,2-oxazol-3-yl)heptanediamide |
|---|---|
| PubChem CID | 45255722 |
| Molecular Formula | C16H19FN4O3 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-N'-(1,2-oxazol-3-yl)heptanediamide |
| SMILES | Nc1cc(F)ccc1NC(=O)CCCCCC(=O)Nc1ccon1 |
| InChI | InChI=1S/C16H19FN4O3/c17-11-6-7-13(12(18)10-11)19-15(22)4-2-1-3-5-16(23)20-14-8-9-24-21-14/h6-10H,1-5,18H2,(H,19,22)(H,20,21,23) |
| InChIKey | RCCXELUCGDFQTD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|