C20H26FN3O2 — CID 137420687
hexyl N-[2-amino-4-[(4-fluorophenyl)methylamino]phenyl]carbamate (PubChem CID 137420687) has the molecular formula C20H26FN3O2 and a molecular weight of 359.45 g/mol. Its IUPAC name is hexyl N-[2-amino-4-[(4-fluorophenyl)methylamino]phenyl]carbamate.
| Compound Name | hexyl N-[2-amino-4-[(4-fluorophenyl)methylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 137420687 |
| Molecular Formula | C20H26FN3O2 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | hexyl N-[2-amino-4-[(4-fluorophenyl)methylamino]phenyl]carbamate |
| SMILES | CCCCCCOC(=O)Nc1ccc(NCc2ccc(F)cc2)cc1N |
| InChI | InChI=1S/C20H26FN3O2/c1-2-3-4-5-12-26-20(25)24-19-11-10-17(13-18(19)22)23-14-15-6-8-16(21)9-7-15/h6-11,13,23H,2-5,12,14,22H2,1H3,(H,24,25) |
| InChIKey | APNJOMCSDNBJJG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|