C16H21FN3O6P — CID 72548935
ethyl N-[2-amino-4-[(4-fluorophenyl)methylamino]phenyl]carbamate;phosphoric acid (PubChem CID 72548935) has the molecular formula C16H21FN3O6P and a molecular weight of 401.33 g/mol. Its IUPAC name is ethyl N-[2-amino-4-[(4-fluorophenyl)methylamino]phenyl]carbamate;phosphoric acid.
| Compound Name | ethyl N-[2-amino-4-[(4-fluorophenyl)methylamino]phenyl]carbamate;phosphoric acid |
|---|---|
| PubChem CID | 72548935 |
| Molecular Formula | C16H21FN3O6P |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | ethyl N-[2-amino-4-[(4-fluorophenyl)methylamino]phenyl]carbamate;phosphoric acid |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccc(F)cc2)cc1N.O=P(O)(O)O |
| InChI | InChI=1S/C16H18FN3O2.H3O4P/c1-2-22-16(21)20-15-8-7-13(9-14(15)18)19-10-11-3-5-12(17)6-4-11;1-5(2,3)4/h3-9,19H,2,10,18H2,1H3,(H,20,21);(H3,1,2,3,4) |
| InChIKey | GAXMCRSEXRYAAY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|