C16H18FN3O2 — CID 129011684
ethyl N-[2-amino-4-[(2-fluorophenyl)methylamino]phenyl]carbamate (PubChem CID 129011684) has the molecular formula C16H18FN3O2 and a molecular weight of 303.34 g/mol. Its IUPAC name is ethyl N-[2-amino-4-[(2-fluorophenyl)methylamino]phenyl]carbamate.
| Compound Name | ethyl N-[2-amino-4-[(2-fluorophenyl)methylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 129011684 |
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | ethyl N-[2-amino-4-[(2-fluorophenyl)methylamino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccccc2F)cc1N |
| InChI | InChI=1S/C16H18FN3O2/c1-2-22-16(21)20-15-8-7-12(9-14(15)18)19-10-11-5-3-4-6-13(11)17/h3-9,19H,2,10,18H2,1H3,(H,20,21) |
| InChIKey | RHILEWLNIGFOJX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|