C18H21Cl2N3O2S — CID 69269790
ethyl N-[2-amino-4-(1-benzothiophen-3-ylmethylamino)phenyl]carbamate;dihydrochloride (PubChem CID 69269790) has the molecular formula C18H21Cl2N3O2S and a molecular weight of 414.36 g/mol. Its IUPAC name is ethyl N-[2-amino-4-(1-benzothiophen-3-ylmethylamino)phenyl]carbamate;dihydrochloride.
| Compound Name | ethyl N-[2-amino-4-(1-benzothiophen-3-ylmethylamino)phenyl]carbamate;dihydrochloride |
|---|---|
| PubChem CID | 69269790 |
| Molecular Formula | C18H21Cl2N3O2S |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | ethyl N-[2-amino-4-(1-benzothiophen-3-ylmethylamino)phenyl]carbamate;dihydrochloride |
| SMILES | CCOC(=O)Nc1ccc(NCc2csc3ccccc23)cc1N.Cl.Cl |
| InChI | InChI=1S/C18H19N3O2S.2ClH/c1-2-23-18(22)21-16-8-7-13(9-15(16)19)20-10-12-11-24-17-6-4-3-5-14(12)17;;/h3-9,11,20H,2,10,19H2,1H3,(H,21,22);2*1H |
| InChIKey | BZKBFMVGHSEZOP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|