C16H21N3O3S — CID 10042590
ethyl N-[2-amino-4-[(3-methoxy-4-methylthiophen-2-yl)methylamino]phenyl]carbamate (PubChem CID 10042590) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is ethyl N-[2-amino-4-[(3-methoxy-4-methylthiophen-2-yl)methylamino]phenyl]carbamate.
| Compound Name | ethyl N-[2-amino-4-[(3-methoxy-4-methylthiophen-2-yl)methylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 10042590 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | ethyl N-[2-amino-4-[(3-methoxy-4-methylthiophen-2-yl)methylamino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCc2scc(C)c2OC)cc1N |
| InChI | InChI=1S/C16H21N3O3S/c1-4-22-16(20)19-13-6-5-11(7-12(13)17)18-8-14-15(21-3)10(2)9-23-14/h5-7,9,18H,4,8,17H2,1-3H3,(H,19,20) |
| InChIKey | QRYFGRRDFHWHPG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|