C13H14N4O4S — CID 134489825
ethyl N-[2-nitro-4-(1,3-thiazol-2-ylmethylamino)phenyl]carbamate (PubChem CID 134489825) has the molecular formula C13H14N4O4S and a molecular weight of 322.35 g/mol. Its IUPAC name is ethyl N-[2-nitro-4-(1,3-thiazol-2-ylmethylamino)phenyl]carbamate.
| Compound Name | ethyl N-[2-nitro-4-(1,3-thiazol-2-ylmethylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 134489825 |
| Molecular Formula | C13H14N4O4S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | ethyl N-[2-nitro-4-(1,3-thiazol-2-ylmethylamino)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCc2nccs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14N4O4S/c1-2-21-13(18)16-10-4-3-9(7-11(10)17(19)20)15-8-12-14-5-6-22-12/h3-7,15H,2,8H2,1H3,(H,16,18) |
| InChIKey | XQXABEUQCWMNJC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|