C16H16F5N3O4S — CID 134493540
ethyl N-[2-nitro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate (PubChem CID 134493540) has the molecular formula C16H16F5N3O4S and a molecular weight of 441.38 g/mol. Its IUPAC name is ethyl N-[2-nitro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate.
| Compound Name | ethyl N-[2-nitro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 134493540 |
| Molecular Formula | C16H16F5N3O4S |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | ethyl N-[2-nitro-4-[[3-(pentafluoro-λ6-sulfanyl)phenyl]methylamino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCc2cccc(S(F)(F)(F)(F)F)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16F5N3O4S/c1-2-28-16(25)23-14-7-6-12(9-15(14)24(26)27)22-10-11-4-3-5-13(8-11)29(17,18,19,20)21/h3-9,22H,2,10H2,1H3,(H,23,25) |
| InChIKey | NNUWTQAJGCRBBP-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|