C24H22FN3O6 — CID 134489838
benzyl N-[4-(ethoxycarbonylamino)-3-nitrophenyl]-N-[(4-fluorophenyl)methyl]carbamate (PubChem CID 134489838) has the molecular formula C24H22FN3O6 and a molecular weight of 467.45 g/mol. Its IUPAC name is benzyl N-[4-(ethoxycarbonylamino)-3-nitrophenyl]-N-[(4-fluorophenyl)methyl]carbamate.
| Compound Name | benzyl N-[4-(ethoxycarbonylamino)-3-nitrophenyl]-N-[(4-fluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 134489838 |
| Molecular Formula | C24H22FN3O6 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | benzyl N-[4-(ethoxycarbonylamino)-3-nitrophenyl]-N-[(4-fluorophenyl)methyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(N(Cc2ccc(F)cc2)C(=O)OCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H22FN3O6/c1-2-33-23(29)26-21-13-12-20(14-22(21)28(31)32)27(15-17-8-10-19(25)11-9-17)24(30)34-16-18-6-4-3-5-7-18/h3-14H,2,15-16H2,1H3,(H,26,29) |
| InChIKey | ZLXQRRIYGISJET-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|