C13H14FN3 — CID 106750257
4-N-[(2-fluorophenyl)methyl]benzene-1,2,4-triamine (PubChem CID 106750257) has the molecular formula C13H14FN3 and a molecular weight of 231.27 g/mol. Its IUPAC name is 4-N-[(2-fluorophenyl)methyl]benzene-1,2,4-triamine.
| Compound Name | 4-N-[(2-fluorophenyl)methyl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 106750257 |
| Molecular Formula | C13H14FN3 |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 4-N-[(2-fluorophenyl)methyl]benzene-1,2,4-triamine |
| SMILES | Nc1ccc(NCc2ccccc2F)cc1N |
| InChI | InChI=1S/C13H14FN3/c14-11-4-2-1-3-9(11)8-17-10-5-6-12(15)13(16)7-10/h1-7,17H,8,15-16H2 |
| InChIKey | VRURQAAATTWJPU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|