C22H29FN4O3 — CID 167224940
ethyl N-[2-(6-aminohexanoylamino)-4-[(4-fluorophenyl)methylamino]phenyl]carbamate (PubChem CID 167224940) has the molecular formula C22H29FN4O3 and a molecular weight of 416.50 g/mol. Its IUPAC name is ethyl N-[2-(6-aminohexanoylamino)-4-[(4-fluorophenyl)methylamino]phenyl]carbamate.
| Compound Name | ethyl N-[2-(6-aminohexanoylamino)-4-[(4-fluorophenyl)methylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 167224940 |
| Molecular Formula | C22H29FN4O3 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | ethyl N-[2-(6-aminohexanoylamino)-4-[(4-fluorophenyl)methylamino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccc(F)cc2)cc1NC(=O)CCCCCN |
| InChI | InChI=1S/C22H29FN4O3/c1-2-30-22(29)27-19-12-11-18(25-15-16-7-9-17(23)10-8-16)14-20(19)26-21(28)6-4-3-5-13-24/h7-12,14,25H,2-6,13,15,24H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | SEGNOSGHGNZOIC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|