C27H34F5N3O — CID 154663628
2,3-difluoro-N-[2-piperidin-1-yl-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]octanamide (PubChem CID 154663628) has the molecular formula C27H34F5N3O and a molecular weight of 511.58 g/mol. Its IUPAC name is 2,3-difluoro-N-[2-piperidin-1-yl-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]octanamide.
| Compound Name | 2,3-difluoro-N-[2-piperidin-1-yl-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]octanamide |
|---|---|
| PubChem CID | 154663628 |
| Molecular Formula | C27H34F5N3O |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 2,3-difluoro-N-[2-piperidin-1-yl-4-[[4-(trifluoromethyl)phenyl]methylamino]phenyl]octanamide |
| SMILES | CCCCCC(F)C(F)C(=O)Nc1ccc(NCc2ccc(C(F)(F)F)cc2)cc1N1CCCCC1 |
| InChI | InChI=1S/C27H34F5N3O/c1-2-3-5-8-22(28)25(29)26(36)34-23-14-13-21(17-24(23)35-15-6-4-7-16-35)33-18-19-9-11-20(12-10-19)27(30,31)32/h9-14,17,22,25,33H,2-8,15-16,18H2,1H3,(H,34,36) |
| InChIKey | IFCGTUIAGFULJA-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|